![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1933_Grebe-Boundy-Cermak_The-controol-of-chemical-processes.pdf | 2022-10-12 12:00 | 24M | |
| 1932_Underwood_Testing-stills-Includes-Fenske-Nmin-and-Lmin.pdf | 2023-10-27 12:53 | 17M | |
| 1995_Bialkowski_Thomasson_From-book-Process-control-fudamentals-for-the-pulp-and-paper-industries.pdf | 2024-01-19 16:46 | 15M | |
| 1966_Murill_Smith_Set PID controllers right - Hydrocarbon Processing.pdf | 2022-10-18 10:55 | 14M | |
| 1960_Kalman - A new approach to linear filtering and prediction problems - Orinal version with comments.pdf | 2023-07-04 10:46 | 9.1M | |
| 1934_Black-feedback-amplifier_Bell-journal.pdf | 2018-10-31 08:46 | 8.7M | |
| 1941_peters_getting the most from automatic control.pdf | 2022-10-16 17:51 | 6.6M | |
| 1962_Boas - Optimization.pdf | 2015-06-15 15:38 | 6.4M | |
| 1990_Chien and Fruehauf - Consider IMC Tuning to Improve Controller Performance - CEP - Oct 1990.pdf | 2023-12-21 14:06 | 6.1M | |
| 1968_Dahlin - Designing and tuning digital controllers.pdf | 2018-09-24 14:52 | 5.5M | |
| 1961_Kalman and Bucy - New results in linear filtering and prediction theory.pdf | 2023-07-04 11:04 | 5.5M | |
| 1933_Olive_Coordinated-efforts-solve-Dows-control-problems.pdf | 2022-10-12 11:58 | 5.0M | |
| 1988_Chien - IMC-PID controller design - An extension - Adchem Symposium.pdf | 2023-12-21 14:23 | 4.5M | |
| 1975_Smith, Corripio and Martin - Controller tuning from simple process models - Instrumentation Technology.pdf | 2023-12-22 12:19 | 3.6M | |
| 1989_Astrom-Rundqwist_anti-windup_ACC-conference.pdf | 2023-02-03 13:30 | 3.5M | |
| 1990_Blickley_Modern-control-started-with-Ziegler-Nichols-tuning.pdf | 2018-12-07 11:32 | 3.3M | |
| 1940_Bode - Relations Between Attenuation and Phase in Feedback Amplifier Design.pdf | 2015-06-15 15:38 | 3.1M | |
| 1937_Grebe_Elements-of-automatic-control.pdf | 2022-10-12 11:57 | 3.0M | |
| 1968_higham.pdf | 2024-01-23 19:02 | 2.9M | |
| 1958 Balchen - A performance Index fer Feedback Control Systems Based on the Fourier Transform of the Control Deviation.pdf | 2015-06-15 15:38 | 2.3M | |
| 2020_leal-hoyo-guzman-hagglund_Double-back-calculation-for-cascade-control_CONTROLO-2020.pdf | 2023-05-29 19:02 | 2.3M | |
| 2005_luyben_ie0580147.pdf | 2010-07-14 06:38 | 2.2M | |
| 1970-smith.pdf | 2018-05-12 21:15 | 2.0M | |
| 1953_Cohen and Coon - Theoretical Consideration of Retarded Control.pdf | 2015-06-15 15:39 | 1.7M | |
| 2017_jaschke-cao-kariwala_review-soc_annual_reviews_control.pdf | 2017-04-18 09:37 | 1.4M | |
| 1978_Richalet_Predictive-control_Automatica.pdf | 2023-11-17 13:32 | 1.3M | |
| 2018_lee_pid-paper.iecr.7b03966.pdf | 2018-04-08 16:54 | 1.2M | |
| 1995_Naysmith-Douglas_Review-RTO.pdf | 2020-07-08 10:09 | 1.2M | |
| 2013_lee-cho-edgar_SIMC-revisited.pdf | 2016-03-16 15:38 | 1.1M | |
| 1980_Sternby_Extremum-seeking-control_JACC1980.pdf | 2018-11-01 13:57 | 1.1M | |
| 1958_Kalman - Design of a Self-Optimizing Control System.pdf | 2015-06-15 15:39 | 1.0M | |
| 1943_ziegler-nichols.pdf | 2015-01-13 17:07 | 957K | |
| 1973_Foss_Critique-of-process-control-theory_AIChEJ.pdf | 2023-01-18 21:19 | 856K | |
| 2005_luyben_ie058015z.pdf | 2010-07-14 06:38 | 846K | |
| 1997_wade-inverted-decoupling.pdf | 2023-03-13 22:23 | 780K | |
| 1942_ziegler-nichols.pdf | 2023-02-05 19:44 | 762K | |
| 1955_lang-han-2dof.pdf | 2016-03-14 13:26 | 744K | |
| 1956-franks-worley-quantitative-analysis-of-cascade-control.pdf | 2024-01-23 12:03 | 657K | |
| 2005_tangirala-shah-thornhill_osc-detection_jpc.pdf | 2010-07-14 06:38 | 636K | |
| 1984_Bennett-PID history.pdf | 2022-09-02 13:44 | 630K | |
| 1932_Fenske-Fractionation-of-straight-run-pennsylvania-gasoline.pdf | 2023-10-27 13:02 | 586K | |
| 2022_jafari_arefi_panahi-jpc-self-optimizing-control-lmi.pdf | 2022-07-02 18:27 | 564K | |
| 1994_schei_pid-controllers_automatica.pdf | 2017-03-01 13:16 | 557K | |
| 1964_Petlyuk, F.B., Platonov, V.M., Girsanov, I.V. The design of optimal rectification cascades. Khim. Prom. No. 6, 45 (445-453) .pdf | 2016-04-08 08:23 | 534K | |
| 1980_Morari-Garcia_Optimizing-control-ESC_JACC1980.pdf | 2018-11-01 14:00 | 514K | |
| 2015_Mayne_NMPC_critique.pdf | 2019-07-03 17:50 | 491K | |
| 2005_barragan-hernandez_optimal-oil-production_cce.pdf | 2010-07-14 06:38 | 437K | |
| 1957_Børdalen - Forslag til norsk terminologi for reguleringsteknikk, serveteknekk m.m..pdf | 2015-06-15 15:39 | 405K | |
| 1965_Petyluk,FB,VM Platonov,DM Slavinskii,Thermodynamically optimal method for separating multicomponent mixtures,International Chemical Engineering,5(4),555-561.pdf | 2016-02-11 10:27 | 399K | |
| 1965_Petyluk,FB,VM Platonov,DM Slavinskii,Thermodynamically optimal method for separating multicomponent mixtures,International Chemical Engineering,5(3),555-561.pdf | 2016-02-11 10:24 | 399K | |
| 2003-araki-2dof-control.pdf | 2016-03-11 18:02 | 399K | |
| 1980_Cutler-Ramaker_Dynamic-matrix-control_JACC1980.pdf | 2018-11-01 13:58 | 387K | |
| 2005_munawar_multilevel-planning_iec.pdf | 2010-07-14 06:38 | 348K | |
| 1955_Rosenbrock The Integral-of-error-squared Criterion For Servo Mechanisms.pdf | 2015-06-15 15:39 | 309K | |
| 2005_tran_mpc-first-prin_cep.pdf | 2010-07-14 06:38 | 305K | |
| 2005_jager_IO_selection.pdf | 2010-07-14 06:38 | 301K | |
| 2008-viteckova-2dof.pdf | 2016-03-11 18:04 | 288K | |
| 2005-goodwin_decentralized_ijc.pdf | 2010-07-14 06:38 | 272K | |
| 2005_agrawal_hydrogen-perspective_aichej.pdf | 2010-07-14 06:38 | 272K | |
| 2019_Nino-Greg Shinskey AIChE Annual Meeting.pdf | 2021-09-28 11:14 | 264K | |
| 2005_low-sorensen_optimal-batch-distillation_aichej.pdf | 2010-07-14 06:38 | 251K | |
| 2005_baldea_modelreduction_jpc.pdf | 2010-07-14 06:38 | 238K | |
| 2016_forsman-dycops2016-0194.pdf | 2023-02-08 20:27 | 235K | |
| 2005_kariwala_decentralized-integrity_automatica.pdf | 2010-07-14 06:38 | 228K | |
| 2004-Kiil-osmotic-pressure-Acta_Physiologica_Scandinavica.pdf | 2018-04-08 17:58 | 217K | |
| 1978_doyle_margins-lqg-there-are-none.pdf | 2020-01-16 11:42 | 212K | |
| 1978_doyleLQGrobustness.pdf | 2019-11-03 21:01 | 212K | |
| 2002_daoutidis_high-purity_iec.pdf | 2010-07-14 06:38 | 211K | |
| 2005_pannochio_mpc-pid_aichej.pdf | 2010-07-14 06:38 | 206K | |
| 2005_foley_comparison-PI_iec.pdf | 2010-07-14 06:38 | 205K | |
| 2005_cao_mpc-analytic-diff_jpc.pdf | 2010-07-14 06:38 | 180K | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2023-09-24 09:14 | 177K | |
| 1960_Kalman - A new approach to linear filtering and prediction problems - OCR version.pdf | 2023-07-04 16:18 | 167K | |
| 2005_he_decentralized-integrity_iec.pdf | 2010-07-14 06:38 | 115K | |
| 2005_kookos_rto-control-structure_iec.pdf | 2010-07-14 06:38 | 111K | |
| 2019_Uhlmann_RGA-nonsquare_Applied-Mathematics-Letters.pdf | 2020-06-10 09:30 | 93K | |
![[DIR]](/icons/folder.gif) | underwood/ | 2023-11-07 13:54 | - | |
| thesis/ | 2015-06-12 11:18 | - | |
| spe-papers/ | 2010-07-14 06:38 | - | |
| selected-papers-ifac05/ | 2010-07-14 06:38 | - | |
| books/ | 2024-02-02 16:01 | - | |
| apc-book-papers/ | 2023-11-17 13:58 | - | |
|
|---|